Description
Inhibits DNA synthesis by inhibiting the enzyme Topoisomerase II. Novobiocin Sodium Salt, MP Biomedicals is an antibiotic produced by Streptomyces nieveus. It is active against gram-positive bacteria. It is also a Hsp90 inhibitor 3.
Novobiocin inhibits DNA synthesis by inhibiting bacterial DNA gyrase targeting the GyrB subunit of the enzyme involved in energy transduction. It acts as a competitive inhibitor of the ATPase reaction catalysed by GyrB 2. Uses include:
- For the production of positively supercoiled plasmid DNA
- Inhibitor of bacterial DNA gyrase and eukaryotic DNA topoisomerase
- Inhibitor of retrovirus RNA-dependent DNA-polymerase
- To study heat shock protein inhibition
CAS | 1476-53-5 |
Molecular Formula | C31H35N2NaO11 |
Molecular Weight (g/mol) | 634.61 |
MDL Number | MFCD00066541,MFCD00066541 |
InChI Key | AXOUUAINTJNFRS-UHFFFAOYNA-N |
Synonym | Albamycin, Cathomycin sodium |
PubChem CID | 131673945 |
SMILES | [Na+].COC1C(OC(N)=O)C(O)C(OC2=CC=C3C(=O)[C-](NC(=O)C4=CC=C(O)C(CC=C(C)C)=C4)C(=O)OC3=C2C)OC1(C)C |